C25H40O6Si — CID 122218281
ethyl (5R)-5-but-3-enyl-4-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-5-methyl-2-oxofuran-3-carboxylate (PubChem CID 122218281) has the molecular formula C25H40O6Si and a molecular weight of 464.68 g/mol. Its IUPAC name is ethyl (5R)-5-but-3-enyl-4-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-5-methyl-2-oxofuran-3-carboxylate.
| Compound Name | ethyl (5R)-5-but-3-enyl-4-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-5-methyl-2-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 122218281 |
| Molecular Formula | C25H40O6Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | ethyl (5R)-5-but-3-enyl-4-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-5-methyl-2-oxofuran-3-carboxylate |
| SMILES | C=CCC[C@@]1(C)OC(=O)C(C(=O)OCC)=C1OC[C@H]1C=CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O6Si/c1-9-11-16-25(6)21(20(23(27)30-25)22(26)28-10-2)29-17-18-14-12-13-15-19(18)31-32(7,8)24(3,4)5/h9,12,14,18-19H,1,10-11,13,15-17H2,2-8H3/t18-,19-,25-/m1/s1 |
| InChIKey | URXDSPZWUOKDJB-MPCDZSKCSA-N |
| XLogP | 5.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|