C21H15F3N2O5 — CID 122218543
methyl (3S,4aR)-3-(3-nitrophenyl)-1-(trifluoromethyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-2-carboxylate (PubChem CID 122218543) has the molecular formula C21H15F3N2O5 and a molecular weight of 432.35 g/mol. Its IUPAC name is methyl (3S,4aR)-3-(3-nitrophenyl)-1-(trifluoromethyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-2-carboxylate.
| Compound Name | methyl (3S,4aR)-3-(3-nitrophenyl)-1-(trifluoromethyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 122218543 |
| Molecular Formula | C21H15F3N2O5 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | methyl (3S,4aR)-3-(3-nitrophenyl)-1-(trifluoromethyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-2-carboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)N2c3ccccc3C=C[C@H]2O[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15F3N2O5/c1-30-20(27)17-18(13-6-4-7-14(11-13)26(28)29)31-16-10-9-12-5-2-3-8-15(12)25(16)19(17)21(22,23)24/h2-11,16,18H,1H3/t16-,18+/m1/s1 |
| InChIKey | HKEFQCZZSPTRCO-AEFFLSMTSA-N |
| XLogP | 4.51 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|