C26H26FNO3 — CID 122219307
ethyl (2R,3S)-3-(4-fluorophenyl)-3-(4-methoxyanilino)-6-methyl-1,2-dihydroindene-2-carboxylate (PubChem CID 122219307) has the molecular formula C26H26FNO3 and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(4-fluorophenyl)-3-(4-methoxyanilino)-6-methyl-1,2-dihydroindene-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-(4-fluorophenyl)-3-(4-methoxyanilino)-6-methyl-1,2-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 122219307 |
| Molecular Formula | C26H26FNO3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl (2R,3S)-3-(4-fluorophenyl)-3-(4-methoxyanilino)-6-methyl-1,2-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2cc(C)ccc2[C@@]1(Nc1ccc(OC)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FNO3/c1-4-31-25(29)24-16-18-15-17(2)5-14-23(18)26(24,19-6-8-20(27)9-7-19)28-21-10-12-22(30-3)13-11-21/h5-15,24,28H,4,16H2,1-3H3/t24-,26-/m0/s1 |
| InChIKey | CQCQESROLMMYTF-AHWVRZQESA-N |
| XLogP | 5.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|