C29H25FN2O3 — CID 122219581
ethyl (2S,3R,4R)-6-fluoro-1'-methyl-2'-oxo-2-phenylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-indole]-4-carboxylate (PubChem CID 122219581) has the molecular formula C29H25FN2O3 and a molecular weight of 468.53 g/mol. Its IUPAC name is ethyl (2S,3R,4R)-6-fluoro-1'-methyl-2'-oxo-2-phenylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-indole]-4-carboxylate.
| Compound Name | ethyl (2S,3R,4R)-6-fluoro-1'-methyl-2'-oxo-2-phenylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-indole]-4-carboxylate |
|---|---|
| PubChem CID | 122219581 |
| Molecular Formula | C29H25FN2O3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | ethyl (2S,3R,4R)-6-fluoro-1'-methyl-2'-oxo-2-phenylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-indole]-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1c2c([nH]c3ccc(F)cc23)C[C@@H](c2ccccc2)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C29H25FN2O3/c1-3-35-27(33)26-25-19-15-18(30)13-14-22(19)31-23(25)16-21(17-9-5-4-6-10-17)29(26)20-11-7-8-12-24(20)32(2)28(29)34/h4-15,21,26,31H,3,16H2,1-2H3/t21-,26-,29+/m0/s1 |
| InChIKey | WBULDURKMWFXPI-YRKLHJTHSA-N |
| XLogP | 5.21 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|