C29H38F3NOSi — CID 122219647
3-[(2R,4R,5R)-3-benzyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 122219647) has the molecular formula C29H38F3NOSi and a molecular weight of 501.71 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-3-benzyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,4R,5R)-3-benzyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 122219647 |
| Molecular Formula | C29H38F3NOSi |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 3-[(2R,4R,5R)-3-benzyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC[C@H]1O[C@H](C(F)(F)F)N(Cc2ccccc2)[C@@H]1c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H38F3NOSi/c1-21(2)35(22(3)4,23(5)6)19-13-18-26-27(25-16-11-8-12-17-25)33(28(34-26)29(30,31)32)20-24-14-9-7-10-15-24/h7-12,14-17,21-23,26-28H,18,20H2,1-6H3/t26-,27-,28-/m1/s1 |
| InChIKey | HFTGDSQWSARTTI-JCYYIGJDSA-N |
| XLogP | 8.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|