C18H18N2S4 — CID 122219667
3,10-diazatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene-3,10-dicarbodithioic acid (PubChem CID 122219667) has the molecular formula C18H18N2S4 and a molecular weight of 390.62 g/mol. Its IUPAC name is 3,10-diazatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene-3,10-dicarbodithioic acid.
| Compound Name | 3,10-diazatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene-3,10-dicarbodithioic acid |
|---|---|
| PubChem CID | 122219667 |
| Molecular Formula | C18H18N2S4 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 3,10-diazatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene-3,10-dicarbodithioic acid |
| SMILES | S=C(S)N1Cc2ccc(cc2)CN(C(=S)S)Cc2ccc(cc2)C1 |
| InChI | InChI=1S/C18H18N2S4/c21-17(22)19-9-13-1-2-14(4-3-13)10-20(18(23)24)12-16-7-5-15(11-19)6-8-16/h1-8H,9-12H2,(H,21,22)(H,23,24) |
| InChIKey | DABVXVKVOHUYTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|