C16H15NO7S — CID 122219713
(2R)-2-acetamido-3-[(1,8-dihydroxy-3,4-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid (PubChem CID 122219713) has the molecular formula C16H15NO7S and a molecular weight of 365.36 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(1,8-dihydroxy-3,4-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(1,8-dihydroxy-3,4-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 122219713 |
| Molecular Formula | C16H15NO7S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (2R)-2-acetamido-3-[(1,8-dihydroxy-3,4-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCC1=C(O)c2c(O)cccc2C(=O)C1=O)C(=O)O |
| InChI | InChI=1S/C16H15NO7S/c1-7(18)17-10(16(23)24)6-25-5-9-13(20)12-8(14(21)15(9)22)3-2-4-11(12)19/h2-4,10,19-20H,5-6H2,1H3,(H,17,18)(H,23,24)/t10-/m0/s1 |
| InChIKey | JTRFFZRAFQSEKJ-JTQLQIEISA-N |
| XLogP | 0.75 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|