C34H10BF15Te — CID 122219742
3,4,5-tris(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-1,4-telluraborinine (PubChem CID 122219742) has the molecular formula C34H10BF15Te and a molecular weight of 841.84 g/mol. Its IUPAC name is 3,4,5-tris(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-1,4-telluraborinine.
| Compound Name | 3,4,5-tris(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-1,4-telluraborinine |
|---|---|
| PubChem CID | 122219742 |
| Molecular Formula | C34H10BF15Te |
| Molecular Weight | 841.84 g/mol |
| Exact Mass | 843.97 |
| IUPAC Name | 3,4,5-tris(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-1,4-telluraborinine |
| SMILES | Fc1c(F)c(F)c(B2C(c3c(F)c(F)c(F)c(F)c3F)=C(c3ccccc3)[Te]C(c3ccccc3)=C2c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C34H10BF15Te/c36-18-13(19(37)25(43)30(48)24(18)42)15-33(11-7-3-1-4-8-11)51-34(12-9-5-2-6-10-12)16(14-20(38)26(44)31(49)27(45)21(14)39)35(15)17-22(40)28(46)32(50)29(47)23(17)41/h1-10H |
| InChIKey | ZEBGHTLPHVLODM-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.84 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|