C18H32N6S — CID 122219804
2-[2-[2-[bis(dimethylamino)methylideneamino]ethylsulfanyl]phenyl]-1,1,3,3-tetramethylguanidine (PubChem CID 122219804) has the molecular formula C18H32N6S and a molecular weight of 364.56 g/mol. Its IUPAC name is 2-[2-[2-[bis(dimethylamino)methylideneamino]ethylsulfanyl]phenyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-[2-[bis(dimethylamino)methylideneamino]ethylsulfanyl]phenyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 122219804 |
| Molecular Formula | C18H32N6S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[2-[2-[bis(dimethylamino)methylideneamino]ethylsulfanyl]phenyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCCSc1ccccc1N=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C18H32N6S/c1-21(2)17(22(3)4)19-13-14-25-16-12-10-9-11-15(16)20-18(23(5)6)24(7)8/h9-12H,13-14H2,1-8H3 |
| InChIKey | YANIYZAQRRKVAV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|