About 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile
2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile (PubChem CID 122220242) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile.
Molecular Properties
| Compound Name | 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile |
| PubChem CID | 122220242 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile |
| SMILES | CCCCc1nc2sccn2c1NC(C#N)CCCC |
| InChI | InChI=1S/C15H22N4S/c1-3-5-7-12(11-16)17-14-13(8-6-4-2)18-15-19(14)9-10-20-15/h9-10,12,17H,3-8H2,1-2H3 |
| InChIKey | UUGYSWCWRCMONU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile?
The IUPAC name of 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile (CID 122220242) is 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile.
What is the SMILES notation for 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile?
The canonical SMILES for 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile is CCCCc1nc2sccn2c1NC(C#N)CCCC.
What is the InChIKey of 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile?
The InChIKey is UUGYSWCWRCMONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4S/c1-3-5-7-12(11-16)17-14-13(8-6-4-2)18-15-19(14)9-10-20-15/h9-10,12,17H,3-8H2,1-2H3.
What are the key properties of 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile?
2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile has a molecular weight of 290.44 g/mol, XLogP of 4.23, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-butylimidazo[2,1-b][1,3]thiazol-5-yl)amino]hexanenitrile is sourced from PubChem (CID 122220242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).