C17H34O4Si — CID 122220293
(1R)-1-[(1S,2S)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)propyl]cyclopropyl]prop-2-en-1-ol (PubChem CID 122220293) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (1R)-1-[(1S,2S)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)propyl]cyclopropyl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(1S,2S)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)propyl]cyclopropyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 122220293 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1R)-1-[(1S,2S)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)propyl]cyclopropyl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@H]1C[C@@H]1[C@@H](OCOC)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-9-15(18)13-10-14(13)16(20-11-19-6)12(2)21-22(7,8)17(3,4)5/h9,12-16,18H,1,10-11H2,2-8H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | QVOHTTHEJXZJEY-CWVYHPPDSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|