C27H21F13N2O2 — CID 122221308
(4S)-4-phenyl-2-[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]nonyl]-4,5-dihydro-1,3-oxazole (PubChem CID 122221308) has the molecular formula C27H21F13N2O2 and a molecular weight of 652.45 g/mol. Its IUPAC name is (4S)-4-phenyl-2-[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]nonyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-phenyl-2-[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]nonyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 122221308 |
| Molecular Formula | C27H21F13N2O2 |
| Molecular Weight | 652.45 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | (4S)-4-phenyl-2-[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]nonyl]-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(C1=N[C@@H](c2ccccc2)CO1)C1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C27H21F13N2O2/c28-22(29,23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40)12-11-17(20-41-18(13-43-20)15-7-3-1-4-8-15)21-42-19(14-44-21)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t18-,19-/m1/s1 |
| InChIKey | VNXRNQZGTRTWAU-RTBURBONSA-N |
| XLogP | 8.46 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.45 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|