C22H18FN5O2 — CID 122221600
[1-[(4-fluorophenyl)methyl]triazol-4-yl]-[2-(4-methoxyanilino)-3-pyridinyl]methanone (PubChem CID 122221600) has the molecular formula C22H18FN5O2 and a molecular weight of 403.42 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]triazol-4-yl]-[2-(4-methoxyanilino)-3-pyridinyl]methanone.
| Compound Name | [1-[(4-fluorophenyl)methyl]triazol-4-yl]-[2-(4-methoxyanilino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 122221600 |
| Molecular Formula | C22H18FN5O2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]triazol-4-yl]-[2-(4-methoxyanilino)-3-pyridinyl]methanone |
| SMILES | COc1ccc(Nc2ncccc2C(=O)c2cn(Cc3ccc(F)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H18FN5O2/c1-30-18-10-8-17(9-11-18)25-22-19(3-2-12-24-22)21(29)20-14-28(27-26-20)13-15-4-6-16(23)7-5-15/h2-12,14H,13H2,1H3,(H,24,25) |
| InChIKey | HMUFHIRZLHCQKB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |