C36H36I4O4S4 — CID 122221654
5,11,17,23-tetraiodo-25,26,27,28-tetrapropoxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene (PubChem CID 122221654) has the molecular formula C36H36I4O4S4 and a molecular weight of 1168.56 g/mol. Its IUPAC name is 5,11,17,23-tetraiodo-25,26,27,28-tetrapropoxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene.
| Compound Name | 5,11,17,23-tetraiodo-25,26,27,28-tetrapropoxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
|---|---|
| PubChem CID | 122221654 |
| Molecular Formula | C36H36I4O4S4 |
| Molecular Weight | 1168.56 g/mol |
| Exact Mass | 1167.77 |
| IUPAC Name | 5,11,17,23-tetraiodo-25,26,27,28-tetrapropoxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
| SMILES | CCCOc1c2cc(I)cc1Sc1cc(I)cc(c1OCCC)Sc1cc(I)cc(c1OCCC)Sc1cc(I)cc(c1OCCC)S2 |
| InChI | InChI=1S/C36H36I4O4S4/c1-5-9-41-33-25-13-21(37)14-26(33)46-28-16-23(39)18-30(35(28)43-11-7-3)48-32-20-24(40)19-31(36(32)44-12-8-4)47-29-17-22(38)15-27(45-25)34(29)42-10-6-2/h13-20H,5-12H2,1-4H3 |
| InChIKey | UMPHDIUUAGUMBS-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.56 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|