C42H56N8O4 — CID 122221751
9,19-dibenzyl-10,20-dimethyl-4,7,14,17-tetra(propan-2-yl)-3,6,9,13,16,19,21,22-octazatricyclo[16.2.1.18,11]docosa-1(20),8(22),10,18(21)-tetraene-2,5,12,15-tetrone (PubChem CID 122221751) has the molecular formula C42H56N8O4 and a molecular weight of 736.96 g/mol. Its IUPAC name is 9,19-dibenzyl-10,20-dimethyl-4,7,14,17-tetra(propan-2-yl)-3,6,9,13,16,19,21,22-octazatricyclo[16.2.1.18,11]docosa-1(20),8(22),10,18(21)-tetraene-2,5,12,15-tetrone.
| Compound Name | 9,19-dibenzyl-10,20-dimethyl-4,7,14,17-tetra(propan-2-yl)-3,6,9,13,16,19,21,22-octazatricyclo[16.2.1.18,11]docosa-1(20),8(22),10,18(21)-tetraene-2,5,12,15-tetrone |
|---|---|
| PubChem CID | 122221751 |
| Molecular Formula | C42H56N8O4 |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.44 |
| IUPAC Name | 9,19-dibenzyl-10,20-dimethyl-4,7,14,17-tetra(propan-2-yl)-3,6,9,13,16,19,21,22-octazatricyclo[16.2.1.18,11]docosa-1(20),8(22),10,18(21)-tetraene-2,5,12,15-tetrone |
| SMILES | Cc1c2nc(n1Cc1ccccc1)C(C(C)C)NC(=O)C(C(C)C)NC(=O)c1nc(n(Cc3ccccc3)c1C)C(C(C)C)NC(=O)C(C(C)C)NC2=O |
| InChI | InChI=1S/C42H56N8O4/c1-23(2)31-37-43-35(27(9)49(37)21-29-17-13-11-14-18-29)41(53)48-34(26(7)8)40(52)46-32(24(3)4)38-44-36(42(54)47-33(25(5)6)39(51)45-31)28(10)50(38)22-30-19-15-12-16-20-30/h11-20,23-26,31-34H,21-22H2,1-10H3,(H,45,51)(H,46,52)(H,47,54)(H,48,53) |
| InChIKey | ZQEMBEDSMSOLFB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |