C22H12F5NOS — CID 122221878
3-(2,3,4,5,6-pentafluorophenyl)-1-(2-pyridin-2-yl-1-benzothiophen-3-yl)propan-1-one (PubChem CID 122221878) has the molecular formula C22H12F5NOS and a molecular weight of 433.40 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-1-(2-pyridin-2-yl-1-benzothiophen-3-yl)propan-1-one.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-1-(2-pyridin-2-yl-1-benzothiophen-3-yl)propan-1-one |
|---|---|
| PubChem CID | 122221878 |
| Molecular Formula | C22H12F5NOS |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-1-(2-pyridin-2-yl-1-benzothiophen-3-yl)propan-1-one |
| SMILES | O=C(CCc1c(F)c(F)c(F)c(F)c1F)c1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C22H12F5NOS/c23-17-12(18(24)20(26)21(27)19(17)25)8-9-14(29)16-11-5-1-2-7-15(11)30-22(16)13-6-3-4-10-28-13/h1-7,10H,8-9H2 |
| InChIKey | LLJZGVGWLVPFOQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|