About 6-cyclohexylhexa-2,4-diynylcyclohexane
6-cyclohexylhexa-2,4-diynylcyclohexane (PubChem CID 122222018) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is 6-cyclohexylhexa-2,4-diynylcyclohexane.
Molecular Properties
| Compound Name | 6-cyclohexylhexa-2,4-diynylcyclohexane |
| PubChem CID | 122222018 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 6-cyclohexylhexa-2,4-diynylcyclohexane |
| SMILES | C(C#CCC1CCCCC1)#CCC1CCCCC1 |
| InChI | InChI=1S/C18H26/c1(5-11-17-13-7-3-8-14-17)2-6-12-18-15-9-4-10-16-18/h17-18H,3-4,7-16H2 |
| InChIKey | JRHVFDOZDUNLHZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexylhexa-2,4-diynylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexylhexa-2,4-diynylcyclohexane?
The IUPAC name of 6-cyclohexylhexa-2,4-diynylcyclohexane (CID 122222018) is 6-cyclohexylhexa-2,4-diynylcyclohexane.
What is the SMILES notation for 6-cyclohexylhexa-2,4-diynylcyclohexane?
The canonical SMILES for 6-cyclohexylhexa-2,4-diynylcyclohexane is C(C#CCC1CCCCC1)#CCC1CCCCC1.
What is the InChIKey of 6-cyclohexylhexa-2,4-diynylcyclohexane?
The InChIKey is JRHVFDOZDUNLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26/c1(5-11-17-13-7-3-8-14-17)2-6-12-18-15-9-4-10-16-18/h17-18H,3-4,7-16H2.
What are the key properties of 6-cyclohexylhexa-2,4-diynylcyclohexane?
6-cyclohexylhexa-2,4-diynylcyclohexane has a molecular weight of 242.41 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexylhexa-2,4-diynylcyclohexane is sourced from PubChem (CID 122222018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).