C18H19NO3 — CID 122222452
(2S,3S,4R)-4-(3-methylphenyl)-3-nitro-2-phenyloxane (PubChem CID 122222452) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2S,3S,4R)-4-(3-methylphenyl)-3-nitro-2-phenyloxane.
| Compound Name | (2S,3S,4R)-4-(3-methylphenyl)-3-nitro-2-phenyloxane |
|---|---|
| PubChem CID | 122222452 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S,3S,4R)-4-(3-methylphenyl)-3-nitro-2-phenyloxane |
| SMILES | Cc1cccc([C@H]2CCO[C@@H](c3ccccc3)[C@H]2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19NO3/c1-13-6-5-9-15(12-13)16-10-11-22-18(17(16)19(20)21)14-7-3-2-4-8-14/h2-9,12,16-18H,10-11H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | KIPVTIMXFCFXCX-SQNIBIBYSA-N |
| XLogP | 3.89 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|