C29H58O9 — CID 122223118
[(6R,17S,18R,21S,22R)-24-[(2R)-2,3-dihydroxypropoxy]-17,18,21,22-tetrahydroxytetracosan-6-yl] acetate (PubChem CID 122223118) has the molecular formula C29H58O9 and a molecular weight of 550.77 g/mol. Its IUPAC name is [(6R,17S,18R,21S,22R)-24-[(2R)-2,3-dihydroxypropoxy]-17,18,21,22-tetrahydroxytetracosan-6-yl] acetate.
| Compound Name | [(6R,17S,18R,21S,22R)-24-[(2R)-2,3-dihydroxypropoxy]-17,18,21,22-tetrahydroxytetracosan-6-yl] acetate |
|---|---|
| PubChem CID | 122223118 |
| Molecular Formula | C29H58O9 |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | [(6R,17S,18R,21S,22R)-24-[(2R)-2,3-dihydroxypropoxy]-17,18,21,22-tetrahydroxytetracosan-6-yl] acetate |
| SMILES | CCCCC[C@H](CCCCCCCCCC[C@H](O)[C@H](O)CC[C@H](O)[C@H](O)CCOC[C@H](O)CO)OC(C)=O |
| InChI | InChI=1S/C29H58O9/c1-3-4-11-14-25(38-23(2)31)15-12-9-7-5-6-8-10-13-16-26(33)27(34)17-18-28(35)29(36)19-20-37-22-24(32)21-30/h24-30,32-36H,3-22H2,1-2H3/t24-,25-,26+,27-,28+,29-/m1/s1 |
| InChIKey | OXPBKSINQNPEAH-WINAUWCFSA-N |
| XLogP | 3.38 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|