C22H18F5NOSi — CID 122223290
9-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-trimethylsilylcarbazol-3-ol (PubChem CID 122223290) has the molecular formula C22H18F5NOSi and a molecular weight of 435.47 g/mol. Its IUPAC name is 9-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-trimethylsilylcarbazol-3-ol.
| Compound Name | 9-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-trimethylsilylcarbazol-3-ol |
|---|---|
| PubChem CID | 122223290 |
| Molecular Formula | C22H18F5NOSi |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 9-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-trimethylsilylcarbazol-3-ol |
| SMILES | Cn1c2ccccc2c2cc(O)c(-c3c(F)c(F)c(F)c(F)c3F)c([Si](C)(C)C)c21 |
| InChI | InChI=1S/C22H18F5NOSi/c1-28-12-8-6-5-7-10(12)11-9-13(29)14(22(21(11)28)30(2,3)4)15-16(23)18(25)20(27)19(26)17(15)24/h5-9,29H,1-4H3 |
| InChIKey | IJHVDEYMRKBSQV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|