C25H25N3 — CID 122223630
1-N,1-N,8-N,8-N-tetramethyl-2-(naphthalene-1-carboximidoyl)naphthalene-1,8-diamine (PubChem CID 122223630) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-N,1-N,8-N,8-N-tetramethyl-2-(naphthalene-1-carboximidoyl)naphthalene-1,8-diamine.
| Compound Name | 1-N,1-N,8-N,8-N-tetramethyl-2-(naphthalene-1-carboximidoyl)naphthalene-1,8-diamine |
|---|---|
| PubChem CID | 122223630 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetramethyl-2-(naphthalene-1-carboximidoyl)naphthalene-1,8-diamine |
| SMILES | [H]/N=C(/c1ccc2cccc(N(C)C)c2c1N(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H25N3/c1-27(2)22-14-8-11-18-15-16-21(25(23(18)22)28(3)4)24(26)20-13-7-10-17-9-5-6-12-19(17)20/h5-16,26H,1-4H3/b26-24+ |
| InChIKey | JBTBVFAEQUIDMD-SHHOIMCASA-N |
| XLogP | 5.54 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|