C28H28N4 — CID 122223639
2,7-bis(benzenecarboximidoyl)-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine (PubChem CID 122223639) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2,7-bis(benzenecarboximidoyl)-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine.
| Compound Name | 2,7-bis(benzenecarboximidoyl)-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 122223639 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2,7-bis(benzenecarboximidoyl)-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
| SMILES | [H]/N=C(\c1ccccc1)c1ccc2ccc(/C(=N/[H])c3ccccc3)c(N(C)C)c2c1N(C)C |
| InChI | InChI=1S/C28H28N4/c1-31(2)27-22(25(29)20-11-7-5-8-12-20)17-15-19-16-18-23(28(24(19)27)32(3)4)26(30)21-13-9-6-10-14-21/h5-18,29-30H,1-4H3/b29-25+,30-26+ |
| InChIKey | PTYSZZFOTQTQTN-XDHTVYJESA-N |
| XLogP | 5.80 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|