C14H24N2O2 — CID 122224076
N-[butan-2-yloxy(pyridin-4-yl)methyl]-2-methoxy-N-methylethanamine (PubChem CID 122224076) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[butan-2-yloxy(pyridin-4-yl)methyl]-2-methoxy-N-methylethanamine.
| Compound Name | N-[butan-2-yloxy(pyridin-4-yl)methyl]-2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 122224076 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-[butan-2-yloxy(pyridin-4-yl)methyl]-2-methoxy-N-methylethanamine |
| SMILES | CCC(C)OC(c1ccncc1)N(C)CCOC |
| InChI | InChI=1S/C14H24N2O2/c1-5-12(2)18-14(16(3)10-11-17-4)13-6-8-15-9-7-13/h6-9,12,14H,5,10-11H2,1-4H3 |
| InChIKey | DRFHFQIHYYSMQA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|