About diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate
diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate (PubChem CID 122224258) has the molecular formula C52H60N2O4
and a molecular weight of 777.06 g/mol. Its IUPAC name is diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate |
| PubChem CID | 122224258 |
| Molecular Formula | C52H60N2O4 |
| Molecular Weight | 777.06 g/mol |
| Exact Mass | 776.46 |
| IUPAC Name | diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCn1c2ccccc2c2cc(-c3cc(C(=O)OCC)c(-c4ccc5c(c4)c4ccccc4n5CCCCCCCC)cc3C(=O)OCC)ccc21 |
| InChI | InChI=1S/C52H60N2O4/c1-5-9-11-13-15-21-31-53-47-25-19-17-23-39(47)43-33-37(27-29-49(43)53)41-35-46(52(56)58-8-4)42(36-45(41)51(55)57-7-3)38-28-30-50-44(34-38)40-24-18-20-26-48(40)54(50)32-22-16-14-12-10-6-2/h17-20,23-30,33-36H,5-16,21-22,31-32H2,1-4H3 |
| InChIKey | OIHGAFSGGUDFRG-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 777.06 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate?
The IUPAC name of diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate (CID 122224258) is diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate is CCCCCCCCn1c2ccccc2c2cc(-c3cc(C(=O)OCC)c(-c4ccc5c(c4)c4ccccc4n5CCCCCCCC)cc3C(=O)OCC)ccc21.
What is the InChIKey of diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate?
The InChIKey is OIHGAFSGGUDFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H60N2O4/c1-5-9-11-13-15-21-31-53-47-25-19-17-23-39(47)43-33-37(27-29-49(43)53)41-35-46(52(56)58-8-4)42(36-45(41)51(55)57-7-3)38-28-30-50-44(34-38)40-24-18-20-26-48(40)54(50)32-22-16-14-12-10-6-2/h17-20,23-30,33-36H,5-16,21-22,31-32H2,1-4H3.
What are the key properties of diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate?
diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate has a molecular weight of 777.06 g/mol, XLogP of 14.31, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-bis(9-octylcarbazol-3-yl)benzene-1,4-dicarboxylate is sourced from PubChem (CID 122224258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).