C15H8F2O3 — CID 122224266
3-(2,2-difluoroacetyl)benzo[c]chromen-6-one (PubChem CID 122224266) has the molecular formula C15H8F2O3 and a molecular weight of 274.22 g/mol. Its IUPAC name is 3-(2,2-difluoroacetyl)benzo[c]chromen-6-one.
| Compound Name | 3-(2,2-difluoroacetyl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 122224266 |
| Molecular Formula | C15H8F2O3 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 3-(2,2-difluoroacetyl)benzo[c]chromen-6-one |
| SMILES | O=C(c1ccc2c(c1)oc(=O)c1ccccc12)C(F)F |
| InChI | InChI=1S/C15H8F2O3/c16-14(17)13(18)8-5-6-10-9-3-1-2-4-11(9)15(19)20-12(10)7-8/h1-7,14H |
| InChIKey | OAUABLMCAPBPHT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|