C12H25N3O6 — CID 122224356
N-[(2R,3R,4R,5S,6R)-2-[3-aminopropyl(methoxy)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 122224356) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[3-aminopropyl(methoxy)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[3-aminopropyl(methoxy)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 122224356 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[3-aminopropyl(methoxy)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CON(CCCN)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H25N3O6/c1-7(17)14-9-11(19)10(18)8(6-16)21-12(9)15(20-2)5-3-4-13/h8-12,16,18-19H,3-6,13H2,1-2H3,(H,14,17)/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | RFRBNQQDDNTOIM-LZQZFOIKSA-N |
| XLogP | -2.86 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|