C16H23FN2O3 — CID 122224392
N-[(2-fluoro-6-methoxyphenyl)methyl]-N',N'-di(propan-2-yl)oxamide (PubChem CID 122224392) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[(2-fluoro-6-methoxyphenyl)methyl]-N',N'-di(propan-2-yl)oxamide.
| Compound Name | N-[(2-fluoro-6-methoxyphenyl)methyl]-N',N'-di(propan-2-yl)oxamide |
|---|---|
| PubChem CID | 122224392 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(2-fluoro-6-methoxyphenyl)methyl]-N',N'-di(propan-2-yl)oxamide |
| SMILES | COc1cccc(F)c1CNC(=O)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H23FN2O3/c1-10(2)19(11(3)4)16(21)15(20)18-9-12-13(17)7-6-8-14(12)22-5/h6-8,10-11H,9H2,1-5H3,(H,18,20) |
| InChIKey | JPLLFFNESUYJIN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|