About tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane
tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane (PubChem CID 122224590) has the molecular formula C18H34OSi
and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane |
| PubChem CID | 122224590 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H](C/C=C/[C@H]1C=CCCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-16(19-20(5,6)18(2,3)4)12-11-15-17-13-9-7-8-10-14-17/h9,11,13,15-17H,7-8,10,12,14H2,1-6H3/b15-11+/t16-,17+/m1/s1 |
| InChIKey | QADWKDVACSJPMY-ZBBFWBNCSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane (CID 122224590) is tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane is C[C@H](C/C=C/[C@H]1C=CCCCC1)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane?
The InChIKey is QADWKDVACSJPMY-ZBBFWBNCSA-N. The full InChI is InChI=1S/C18H34OSi/c1-16(19-20(5,6)18(2,3)4)12-11-15-17-13-9-7-8-10-14-17/h9,11,13,15-17H,7-8,10,12,14H2,1-6H3/b15-11+/t16-,17+/m1/s1.
What are the key properties of tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane?
tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane has a molecular weight of 294.56 g/mol, XLogP of 6.09, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E,2R)-5-[(1R)-cyclohept-2-en-1-yl]pent-4-en-2-yl]oxy-dimethylsilane is sourced from PubChem (CID 122224590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).