C14H15Cl2F3O — CID 122224679
(3R,4R)-3-(3,5-dichlorophenyl)-7,7,7-trifluoro-3-methylhept-1-en-4-ol (PubChem CID 122224679) has the molecular formula C14H15Cl2F3O and a molecular weight of 327.17 g/mol. Its IUPAC name is (3R,4R)-3-(3,5-dichlorophenyl)-7,7,7-trifluoro-3-methylhept-1-en-4-ol.
| Compound Name | (3R,4R)-3-(3,5-dichlorophenyl)-7,7,7-trifluoro-3-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 122224679 |
| Molecular Formula | C14H15Cl2F3O |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (3R,4R)-3-(3,5-dichlorophenyl)-7,7,7-trifluoro-3-methylhept-1-en-4-ol |
| SMILES | C=C[C@](C)(c1cc(Cl)cc(Cl)c1)[C@H](O)CCC(F)(F)F |
| InChI | InChI=1S/C14H15Cl2F3O/c1-3-13(2,12(20)4-5-14(17,18)19)9-6-10(15)8-11(16)7-9/h3,6-8,12,20H,1,4-5H2,2H3/t12-,13-/m1/s1 |
| InChIKey | KDDWWVKQHFLXLP-CHWSQXEVSA-N |
| XLogP | 5.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|