About (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane
(4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane (PubChem CID 122225000) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane |
| PubChem CID | 122225000 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane |
| SMILES | C=C[C@@]1(c2ccccc2)COC(C)O1 |
| InChI | InChI=1S/C12H14O2/c1-3-12(9-13-10(2)14-12)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3/t10?,12-/m0/s1 |
| InChIKey | FXIBQAWVNXIQME-KFJBMODSSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane?
The IUPAC name of (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane (CID 122225000) is (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane.
What is the SMILES notation for (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane?
The canonical SMILES for (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane is C=C[C@@]1(c2ccccc2)COC(C)O1.
What is the InChIKey of (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane?
The InChIKey is FXIBQAWVNXIQME-KFJBMODSSA-N. The full InChI is InChI=1S/C12H14O2/c1-3-12(9-13-10(2)14-12)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3/t10?,12-/m0/s1.
What are the key properties of (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane?
(4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane has a molecular weight of 190.24 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethenyl-2-methyl-4-phenyl-1,3-dioxolane is sourced from PubChem (CID 122225000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).