C30H24O4P2S — CID 122225176
5,7-bis(diphenylphosphoryl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 122225176) has the molecular formula C30H24O4P2S and a molecular weight of 542.53 g/mol. Its IUPAC name is 5,7-bis(diphenylphosphoryl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis(diphenylphosphoryl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 122225176 |
| Molecular Formula | C30H24O4P2S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 5,7-bis(diphenylphosphoryl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1sc(P(=O)(c2ccccc2)c2ccccc2)c2c1OCCO2 |
| InChI | InChI=1S/C30H24O4P2S/c31-35(23-13-5-1-6-14-23,24-15-7-2-8-16-24)29-27-28(34-22-21-33-27)30(37-29)36(32,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2 |
| InChIKey | NUFYAIDUEMBDEQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|