C26H28N2O4 — CID 122225290
methyl (1R,2S,6R,7S)-7-(4-tert-butylphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate (PubChem CID 122225290) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl (1R,2S,6R,7S)-7-(4-tert-butylphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate.
| Compound Name | methyl (1R,2S,6R,7S)-7-(4-tert-butylphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
|---|---|
| PubChem CID | 122225290 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl (1R,2S,6R,7S)-7-(4-tert-butylphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@](c3ccc(C(C)(C)C)cc3)(N1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H28N2O4/c1-24(2,3)16-10-12-17(13-11-16)25-14-15-26(27-25,23(31)32-4)20-19(25)21(29)28(22(20)30)18-8-6-5-7-9-18/h5-13,19-20,27H,14-15H2,1-4H3/t19-,20+,25+,26+/m0/s1 |
| InChIKey | QPBBKUDGMSRHEB-BLNVZXSVSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|