C30H41BN2O4 — CID 122225904
N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide (PubChem CID 122225904) has the molecular formula C30H41BN2O4 and a molecular weight of 504.48 g/mol. Its IUPAC name is N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide.
| Compound Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 122225904 |
| Molecular Formula | C30H41BN2O4 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide |
| SMILES | CCC(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C30H41BN2O4/c1-6-26(34)33(21-22-14-9-7-10-15-22)27(28(35)32-25-18-11-8-12-19-25)23-16-13-17-24(20-23)31-36-29(2,3)30(4,5)37-31/h7,9-10,13-17,20,25,27H,6,8,11-12,18-19,21H2,1-5H3,(H,32,35) |
| InChIKey | XKGGQIZFSPRQQA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|