C29H39BN2O4 — CID 122225907
2-[acetyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]-N-cyclohexyl-2-phenylacetamide (PubChem CID 122225907) has the molecular formula C29H39BN2O4 and a molecular weight of 490.45 g/mol. Its IUPAC name is 2-[acetyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]-N-cyclohexyl-2-phenylacetamide.
| Compound Name | 2-[acetyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]-N-cyclohexyl-2-phenylacetamide |
|---|---|
| PubChem CID | 122225907 |
| Molecular Formula | C29H39BN2O4 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 2-[acetyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]-N-cyclohexyl-2-phenylacetamide |
| SMILES | CC(=O)N(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(C(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C29H39BN2O4/c1-21(33)32(20-22-16-18-24(19-17-22)30-35-28(2,3)29(4,5)36-30)26(23-12-8-6-9-13-23)27(34)31-25-14-10-7-11-15-25/h6,8-9,12-13,16-19,25-26H,7,10-11,14-15,20H2,1-5H3,(H,31,34) |
| InChIKey | YRANTLZILWOEOK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|