C19H20BNO2 — CID 122226132
[(1S,11R)-9-phenyl-9-azatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl]boronic acid (PubChem CID 122226132) has the molecular formula C19H20BNO2 and a molecular weight of 305.19 g/mol. Its IUPAC name is [(1S,11R)-9-phenyl-9-azatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl]boronic acid.
| Compound Name | [(1S,11R)-9-phenyl-9-azatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl]boronic acid |
|---|---|
| PubChem CID | 122226132 |
| Molecular Formula | C19H20BNO2 |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [(1S,11R)-9-phenyl-9-azatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl]boronic acid |
| SMILES | OB(O)c1ccc2c(c1)C1C([C@@H]3CC[C@H]1C3)N2c1ccccc1 |
| InChI | InChI=1S/C19H20BNO2/c22-20(23)14-8-9-17-16(11-14)18-12-6-7-13(10-12)19(18)21(17)15-4-2-1-3-5-15/h1-5,8-9,11-13,18-19,22-23H,6-7,10H2/t12-,13+,18?,19?/m0/s1 |
| InChIKey | YQBQTIWDRPLCPE-BFZHTFRTSA-N |
| XLogP | 2.40 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|