C25H40O7 — CID 122226191
(3R,4R,5E,7R,11S,12S)-3,4-dihydroxy-12-[(E,4R)-4-[(2R,3R,4R)-4-methoxy-3-methyl-6-oxooxan-2-yl]pent-2-en-2-yl]-7,11-dimethyl-1-oxacyclododec-5-en-2-one (PubChem CID 122226191) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is (3R,4R,5E,7R,11S,12S)-3,4-dihydroxy-12-[(E,4R)-4-[(2R,3R,4R)-4-methoxy-3-methyl-6-oxooxan-2-yl]pent-2-en-2-yl]-7,11-dimethyl-1-oxacyclododec-5-en-2-one.
| Compound Name | (3R,4R,5E,7R,11S,12S)-3,4-dihydroxy-12-[(E,4R)-4-[(2R,3R,4R)-4-methoxy-3-methyl-6-oxooxan-2-yl]pent-2-en-2-yl]-7,11-dimethyl-1-oxacyclododec-5-en-2-one |
|---|---|
| PubChem CID | 122226191 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (3R,4R,5E,7R,11S,12S)-3,4-dihydroxy-12-[(E,4R)-4-[(2R,3R,4R)-4-methoxy-3-methyl-6-oxooxan-2-yl]pent-2-en-2-yl]-7,11-dimethyl-1-oxacyclododec-5-en-2-one |
| SMILES | CO[C@@H]1CC(=O)O[C@H]([C@H](C)/C=C(\C)[C@H]2OC(=O)[C@H](O)[C@H](O)/C=C/[C@H](C)CCC[C@@H]2C)[C@@H]1C |
| InChI | InChI=1S/C25H40O7/c1-14-8-7-9-15(2)23(32-25(29)22(28)19(26)11-10-14)16(3)12-17(4)24-18(5)20(30-6)13-21(27)31-24/h10-12,14-15,17-20,22-24,26,28H,7-9,13H2,1-6H3/b11-10+,16-12+/t14-,15+,17-,18-,19-,20-,22-,23+,24-/m1/s1 |
| InChIKey | ATUPLAXMGVMDBS-CRTAWCAISA-N |
| XLogP | 3.18 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|