C39H55NO5Si — CID 122226266
(4R)-3-[(2R,3S,4E)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-9-methyl-2-(3-methylbut-3-enyl)deca-4,8-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 122226266) has the molecular formula C39H55NO5Si and a molecular weight of 645.96 g/mol. Its IUPAC name is (4R)-3-[(2R,3S,4E)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-9-methyl-2-(3-methylbut-3-enyl)deca-4,8-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3S,4E)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-9-methyl-2-(3-methylbut-3-enyl)deca-4,8-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 122226266 |
| Molecular Formula | C39H55NO5Si |
| Molecular Weight | 645.96 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | (4R)-3-[(2R,3S,4E)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-9-methyl-2-(3-methylbut-3-enyl)deca-4,8-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CC[C@@H](C(=O)N1C(=O)OC[C@H]1C(C)C)[C@@H](O)/C=C(\CCC=C(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H55NO5Si/c1-28(2)17-16-18-31(25-36(41)34(24-23-29(3)4)37(42)40-35(30(5)6)27-44-38(40)43)26-45-46(39(7,8)9,32-19-12-10-13-20-32)33-21-14-11-15-22-33/h10-15,17,19-22,25,30,34-36,41H,3,16,18,23-24,26-27H2,1-2,4-9H3/b31-25+/t34-,35+,36+/m1/s1 |
| InChIKey | CIWQXJVNGANTCZ-VXPLJSTGSA-N |
| XLogP | 7.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.96 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|