About CID 122226472
CID 122226472 (PubChem CID 122226472) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol.
Molecular Properties
| Compound Name | CID 122226472 |
| PubChem CID | 122226472 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@]2(SC[C@H](O)[C@]23C(=O)N(C)c2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C20H18N2O3S/c1-21-14-9-5-3-7-12(14)19(17(21)24)16(23)11-26-20(19)13-8-4-6-10-15(13)22(2)18(20)25/h3-10,16,23H,11H2,1-2H3/t16-,19+,20+/m0/s1 |
| InChIKey | WDKZQIHJWAKCBI-PWIZWCRZSA-N |
| XLogP | 1.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 122226472 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122226472?
The IUPAC name of CID 122226472 (CID 122226472) is not available.
What is the SMILES notation for CID 122226472?
The canonical SMILES for CID 122226472 is CN1C(=O)[C@]2(SC[C@H](O)[C@]23C(=O)N(C)c2ccccc23)c2ccccc21.
What is the InChIKey of CID 122226472?
The InChIKey is WDKZQIHJWAKCBI-PWIZWCRZSA-N. The full InChI is InChI=1S/C20H18N2O3S/c1-21-14-9-5-3-7-12(14)19(17(21)24)16(23)11-26-20(19)13-8-4-6-10-15(13)22(2)18(20)25/h3-10,16,23H,11H2,1-2H3/t16-,19+,20+/m0/s1.
What are the key properties of CID 122226472?
CID 122226472 has a molecular weight of 366.44 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122226472 is sourced from PubChem (CID 122226472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).