C22H24N4O6 — CID 122226545
methyl (2S)-2-[[4-[[4-[[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoate (PubChem CID 122226545) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[[4-[[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[4-[[4-[[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 122226545 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | methyl (2S)-2-[[4-[[4-[[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)c1ccc(/N=N/c2ccc(C(=O)N[C@H](C)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O6/c1-13(21(29)31-3)23-19(27)15-5-9-17(10-6-15)25-26-18-11-7-16(8-12-18)20(28)24-14(2)22(30)32-4/h5-14H,1-4H3,(H,23,27)(H,24,28)/b26-25+/t13-,14+ |
| InChIKey | WSPWJHRKOWDWMG-XIKBEQKASA-N |
| XLogP | 2.68 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|