C9H8ClN3O2 — CID 122226815
1-[(6-chloro-3-pyridinyl)methyl]imidazolidine-2,4-dione (PubChem CID 122226815) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.64 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 122226815 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(Cc2ccc(Cl)nc2)C(=O)N1 |
| InChI | InChI=1S/C9H8ClN3O2/c10-7-2-1-6(3-11-7)4-13-5-8(14)12-9(13)15/h1-3H,4-5H2,(H,12,14,15) |
| InChIKey | QIDUXKAQZLOGDF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|