C69H57N9O6 — CID 122226842
4-[2-[3,5-bis[2-[2,6-bis(6-ethoxy-2-pyridinyl)-4-pyridinyl]ethynyl]phenyl]ethynyl]-2,6-bis(6-ethoxy-2-pyridinyl)pyridine (PubChem CID 122226842) has the molecular formula C69H57N9O6 and a molecular weight of 1108.27 g/mol. Its IUPAC name is 4-[2-[3,5-bis[2-[2,6-bis(6-ethoxy-2-pyridinyl)-4-pyridinyl]ethynyl]phenyl]ethynyl]-2,6-bis(6-ethoxy-2-pyridinyl)pyridine.
| Compound Name | 4-[2-[3,5-bis[2-[2,6-bis(6-ethoxy-2-pyridinyl)-4-pyridinyl]ethynyl]phenyl]ethynyl]-2,6-bis(6-ethoxy-2-pyridinyl)pyridine |
|---|---|
| PubChem CID | 122226842 |
| Molecular Formula | C69H57N9O6 |
| Molecular Weight | 1108.27 g/mol |
| Exact Mass | 1107.44 |
| IUPAC Name | 4-[2-[3,5-bis[2-[2,6-bis(6-ethoxy-2-pyridinyl)-4-pyridinyl]ethynyl]phenyl]ethynyl]-2,6-bis(6-ethoxy-2-pyridinyl)pyridine |
| SMILES | CCOc1cccc(-c2cc(C#Cc3cc(C#Cc4cc(-c5cccc(OCC)n5)nc(-c5cccc(OCC)n5)c4)cc(C#Cc4cc(-c5cccc(OCC)n5)nc(-c5cccc(OCC)n5)c4)c3)cc(-c3cccc(OCC)n3)n2)n1 |
| InChI | InChI=1S/C69H57N9O6/c1-7-79-64-25-13-19-52(73-64)58-40-49(41-59(70-58)53-20-14-26-65(74-53)80-8-2)34-31-46-37-47(32-35-50-42-60(54-21-15-27-66(75-54)81-9-3)71-61(43-50)55-22-16-28-67(76-55)82-10-4)39-48(38-46)33-36-51-44-62(56-23-17-29-68(77-56)83-11-5)72-63(45-51)57-24-18-30-69(78-57)84-12-6/h13-30,37-45H,7-12H2,1-6H3 |
| InChIKey | LDFBNPGULDENHQ-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 171.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.27 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|