About tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate
tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate (PubChem CID 122227368) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate.
Molecular Properties
| Compound Name | tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate |
| PubChem CID | 122227368 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate |
| SMILES | CCCC=C=C(COC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22O4/c1-6-7-8-9-12(10-17-11(2)15)13(16)18-14(3,4)5/h8H,6-7,10H2,1-5H3 |
| InChIKey | XBAHRIOBDZEDPY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate?
The IUPAC name of tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate (CID 122227368) is tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate.
What is the SMILES notation for tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate?
The canonical SMILES for tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate is CCCC=C=C(COC(C)=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate?
The InChIKey is XBAHRIOBDZEDPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-6-7-8-9-12(10-17-11(2)15)13(16)18-14(3,4)5/h8H,6-7,10H2,1-5H3.
What are the key properties of tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate?
tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate has a molecular weight of 254.33 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(acetyloxymethyl)hepta-2,3-dienoate is sourced from PubChem (CID 122227368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).