C18H15ClN2O2 — CID 122227390
(3aS,9bR)-2-(4-chlorophenyl)-5-methyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 122227390) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is (3aS,9bR)-2-(4-chlorophenyl)-5-methyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | (3aS,9bR)-2-(4-chlorophenyl)-5-methyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 122227390 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (3aS,9bR)-2-(4-chlorophenyl)-5-methyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | CN1C[C@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@H]2c2ccccc21 |
| InChI | InChI=1S/C18H15ClN2O2/c1-20-10-14-16(13-4-2-3-5-15(13)20)18(23)21(17(14)22)12-8-6-11(19)7-9-12/h2-9,14,16H,10H2,1H3/t14-,16+/m1/s1 |
| InChIKey | VTWNHMHVZDENOK-ZBFHGGJFSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|