C36H33NO6 — CID 122227442
11-(dihexylamino)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 122227442) has the molecular formula C36H33NO6 and a molecular weight of 575.66 g/mol. Its IUPAC name is 11-(dihexylamino)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11-(dihexylamino)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 122227442 |
| Molecular Formula | C36H33NO6 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 11-(dihexylamino)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CCCCCCN(CCCCCC)c1cc2c3c(ccc4c5ccc6c7c(ccc(c1c34)c75)C(=O)OC6=O)C(=O)OC2=O |
| InChI | InChI=1S/C36H33NO6/c1-3-5-7-9-17-37(18-10-8-6-4-2)27-19-26-30-25(35(40)43-36(26)41)15-12-21-20-11-14-23-29-24(34(39)42-33(23)38)16-13-22(28(20)29)31(27)32(21)30/h11-16,19H,3-10,17-18H2,1-2H3 |
| InChIKey | KXUZAFZSYCALGU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|