About 3-(4-bromophenyl)-1,5,3-dithiazonane
3-(4-bromophenyl)-1,5,3-dithiazonane (PubChem CID 122227463) has the molecular formula C12H16BrNS2
and a molecular weight of 318.30 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,5,3-dithiazonane.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-1,5,3-dithiazonane |
| PubChem CID | 122227463 |
| Molecular Formula | C12H16BrNS2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-(4-bromophenyl)-1,5,3-dithiazonane |
| SMILES | Brc1ccc(N2CSCCCCSC2)cc1 |
| InChI | InChI=1S/C12H16BrNS2/c13-11-3-5-12(6-4-11)14-9-15-7-1-2-8-16-10-14/h3-6H,1-2,7-10H2 |
| InChIKey | TYXDNNMLYNTRBQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromophenyl)-1,5,3-dithiazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-1,5,3-dithiazonane?
The IUPAC name of 3-(4-bromophenyl)-1,5,3-dithiazonane (CID 122227463) is 3-(4-bromophenyl)-1,5,3-dithiazonane.
What is the SMILES notation for 3-(4-bromophenyl)-1,5,3-dithiazonane?
The canonical SMILES for 3-(4-bromophenyl)-1,5,3-dithiazonane is Brc1ccc(N2CSCCCCSC2)cc1.
What is the InChIKey of 3-(4-bromophenyl)-1,5,3-dithiazonane?
The InChIKey is TYXDNNMLYNTRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNS2/c13-11-3-5-12(6-4-11)14-9-15-7-1-2-8-16-10-14/h3-6H,1-2,7-10H2.
What are the key properties of 3-(4-bromophenyl)-1,5,3-dithiazonane?
3-(4-bromophenyl)-1,5,3-dithiazonane has a molecular weight of 318.30 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-1,5,3-dithiazonane is sourced from PubChem (CID 122227463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).