C10H11F7N2OSi — CID 122227772
2,2-difluoro-1-[5-(1,1,2,2,2-pentafluoroethyl)-3-trimethylsilyl-1H-pyrazol-4-yl]ethanone (PubChem CID 122227772) has the molecular formula C10H11F7N2OSi and a molecular weight of 336.28 g/mol. Its IUPAC name is 2,2-difluoro-1-[5-(1,1,2,2,2-pentafluoroethyl)-3-trimethylsilyl-1H-pyrazol-4-yl]ethanone.
| Compound Name | 2,2-difluoro-1-[5-(1,1,2,2,2-pentafluoroethyl)-3-trimethylsilyl-1H-pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 122227772 |
| Molecular Formula | C10H11F7N2OSi |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2,2-difluoro-1-[5-(1,1,2,2,2-pentafluoroethyl)-3-trimethylsilyl-1H-pyrazol-4-yl]ethanone |
| SMILES | C[Si](C)(C)c1n[nH]c(C(F)(F)C(F)(F)F)c1C(=O)C(F)F |
| InChI | InChI=1S/C10H11F7N2OSi/c1-21(2,3)8-4(5(20)7(11)12)6(18-19-8)9(13,14)10(15,16)17/h7H,1-3H3,(H,18,19) |
| InChIKey | MYOQWHPUGHCETE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|