C64H81O4P — CID 122227886
10,16-bis[4-(1-adamantyl)-2,6-di(propan-2-yl)phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide (PubChem CID 122227886) has the molecular formula C64H81O4P and a molecular weight of 945.32 g/mol. Its IUPAC name is 10,16-bis[4-(1-adamantyl)-2,6-di(propan-2-yl)phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide.
| Compound Name | 10,16-bis[4-(1-adamantyl)-2,6-di(propan-2-yl)phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide |
|---|---|
| PubChem CID | 122227886 |
| Molecular Formula | C64H81O4P |
| Molecular Weight | 945.32 g/mol |
| Exact Mass | 944.59 |
| IUPAC Name | 10,16-bis[4-(1-adamantyl)-2,6-di(propan-2-yl)phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide |
| SMILES | CC(C)c1cc(C23CC4CC(CC(C4)C2)C3)cc(C(C)C)c1-c1cc2c(c3c1OP(=O)(O)Oc1c(-c4c(C(C)C)cc(C56CC7CC(CC(C7)C5)C6)cc4C(C)C)cc4c(c1-3)CCCC4)CCCC2 |
| InChI | InChI=1S/C64H81O4P/c1-35(2)51-25-47(63-29-39-17-40(30-63)19-41(18-39)31-63)26-52(36(3)4)57(51)55-23-45-13-9-11-15-49(45)59-60-50-16-12-10-14-46(50)24-56(62(60)68-69(65,66)67-61(55)59)58-53(37(5)6)27-48(28-54(58)38(7)8)64-32-42-20-43(33-64)22-44(21-42)34-64/h23-28,35-44H,9-22,29-34H2,1-8H3,(H,65,66) |
| InChIKey | DKJIMCDJWBCZEH-UHFFFAOYSA-N |
| XLogP | 17.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.32 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|