C21H36O4Si — CID 122227968
(3aR,10bR)-10b-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,7,8,9-hexahydro-3aH-cyclohepta[g][1,3]benzodioxol-10-one (PubChem CID 122227968) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (3aR,10bR)-10b-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,7,8,9-hexahydro-3aH-cyclohepta[g][1,3]benzodioxol-10-one.
| Compound Name | (3aR,10bR)-10b-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,7,8,9-hexahydro-3aH-cyclohepta[g][1,3]benzodioxol-10-one |
|---|---|
| PubChem CID | 122227968 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3aR,10bR)-10b-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,7,8,9-hexahydro-3aH-cyclohepta[g][1,3]benzodioxol-10-one |
| SMILES | CC1(C)O[C@@H]2CCC3=C(C(=O)CCCC3)[C@]2(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H36O4Si/c1-19(2,3)26(6,7)23-14-21-17(24-20(4,5)25-21)13-12-15-10-8-9-11-16(22)18(15)21/h17H,8-14H2,1-7H3/t17-,21-/m1/s1 |
| InChIKey | WVABGOPXCWFANE-DYESRHJHSA-N |
| XLogP | 5.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|