C32H29NO — CID 122228206
4-[(1Z)-1,3-bis(4-phenylphenyl)buta-1,3-dienyl]morpholine (PubChem CID 122228206) has the molecular formula C32H29NO and a molecular weight of 443.59 g/mol. Its IUPAC name is 4-[(1Z)-1,3-bis(4-phenylphenyl)buta-1,3-dienyl]morpholine.
| Compound Name | 4-[(1Z)-1,3-bis(4-phenylphenyl)buta-1,3-dienyl]morpholine |
|---|---|
| PubChem CID | 122228206 |
| Molecular Formula | C32H29NO |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-[(1Z)-1,3-bis(4-phenylphenyl)buta-1,3-dienyl]morpholine |
| SMILES | C=C(/C=C(/c1ccc(-c2ccccc2)cc1)N1CCOCC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H29NO/c1-25(26-12-14-29(15-13-26)27-8-4-2-5-9-27)24-32(33-20-22-34-23-21-33)31-18-16-30(17-19-31)28-10-6-3-7-11-28/h2-19,24H,1,20-23H2/b32-24- |
| InChIKey | IISRXAIQAYVWKH-TZHWMEPESA-N |
| XLogP | 7.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|