C22H26N4-2 — CID 122228468
2,15-diaza-7,20-diazanidatricyclo[19.5.0.08,14]hexacosa-1,8,10,12,14,21,23,25-octaene (PubChem CID 122228468) has the molecular formula C22H26N4-2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2,15-diaza-7,20-diazanidatricyclo[19.5.0.08,14]hexacosa-1,8,10,12,14,21,23,25-octaene.
| Compound Name | 2,15-diaza-7,20-diazanidatricyclo[19.5.0.08,14]hexacosa-1,8,10,12,14,21,23,25-octaene |
|---|---|
| PubChem CID | 122228468 |
| Molecular Formula | C22H26N4-2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2,15-diaza-7,20-diazanidatricyclo[19.5.0.08,14]hexacosa-1,8,10,12,14,21,23,25-octaene |
| SMILES | C1=CC=C2[N-]CCCC/N=C3\C=CC=CC=C3[N-]CCCC/N=C/2C=C1 |
| InChI | InChI=1S/C22H26N4/c1-3-11-19-20(12-4-1)24-16-8-10-18-26-22-14-6-2-5-13-21(22)25-17-9-7-15-23-19/h1-6,11-14H,7-10,15-18H2/q-2/b23-19+,26-22+ |
| InChIKey | XDDWDTIZCDCFMH-SMKWTANGSA-N |
| XLogP | 5.21 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |